C16H15N5O — CID 661952
N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-2-phenylacetamide (PubChem CID 661952) has the molecular formula C16H15N5O and a molecular weight of 293.33 g/mol. Its IUPAC name is N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-2-phenylacetamide.
| Compound Name | N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 661952 |
| Molecular Formula | C16H15N5O |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-2-phenylacetamide |
| SMILES | Nc1nc(NC(=O)Cc2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C16H15N5O/c17-15-19-16(20-21(15)13-9-5-2-6-10-13)18-14(22)11-12-7-3-1-4-8-12/h1-10H,11H2,(H3,17,18,19,20,22) |
| InChIKey | QPIOHWQOBCJVBE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |