C42H88O10P2S — CID 173083760
bis(tris(hydroxymethyl)-octadec-9-enylphosphanium);sulfate (PubChem CID 173083760) has the molecular formula C42H88O10P2S and a molecular weight of 847.17 g/mol. Its IUPAC name is bis(tris(hydroxymethyl)-octadec-9-enylphosphanium);sulfate.
| Compound Name | bis(tris(hydroxymethyl)-octadec-9-enylphosphanium);sulfate |
|---|---|
| PubChem CID | 173083760 |
| Molecular Formula | C42H88O10P2S |
| Molecular Weight | 847.17 g/mol |
| Exact Mass | 846.56 |
| IUPAC Name | bis(tris(hydroxymethyl)-octadec-9-enylphosphanium);sulfate |
| SMILES | CCCCCCCCC=CCCCCCCCC[P+](CO)(CO)CO.CCCCCCCCC=CCCCCCCCC[P+](CO)(CO)CO.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C21H44O3P.H2O4S/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-25(19-22,20-23)21-24;1-5(2,3)4/h2*9-10,22-24H,2-8,11-21H2,1H3;(H2,1,2,3,4)/q2*+1;/p-2 |
| InChIKey | FVRDKWXKVARSDU-UHFFFAOYSA-L |
| XLogP | 10.44 |
| TPSA | 201.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.17 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|