C26H50 — CID 173085741
1,4-diethyl-1-propylcyclohexane;1-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 173085741) has the molecular formula C26H50 and a molecular weight of 362.69 g/mol. Its IUPAC name is 1,4-diethyl-1-propylcyclohexane;1-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 1,4-diethyl-1-propylcyclohexane;1-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 173085741 |
| Molecular Formula | C26H50 |
| Molecular Weight | 362.69 g/mol |
| Exact Mass | 362.39 |
| IUPAC Name | 1,4-diethyl-1-propylcyclohexane;1-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCC1(CC)CCC(CC)CC1.CCCC1CCCC2CCCCC12 |
| InChI | InChI=1S/C13H24.C13H26/c1-2-6-11-8-5-9-12-7-3-4-10-13(11)12;1-4-9-13(6-3)10-7-12(5-2)8-11-13/h11-13H,2-10H2,1H3;12H,4-11H2,1-3H3 |
| InChIKey | AUIARKMTFKQJDE-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.69 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |