C23H26N2O3S — CID 173087477
(2-amino-2-oxoethyl) 2-[2-(1-methylpiperidin-4-ylidene)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-5-yl]acetate (PubChem CID 173087477) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 2-[2-(1-methylpiperidin-4-ylidene)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-5-yl]acetate.
| Compound Name | (2-amino-2-oxoethyl) 2-[2-(1-methylpiperidin-4-ylidene)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-5-yl]acetate |
|---|---|
| PubChem CID | 173087477 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | (2-amino-2-oxoethyl) 2-[2-(1-methylpiperidin-4-ylidene)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-5-yl]acetate |
| SMILES | CN1CCC(=C2c3ccccc3CCc3sc(CC(=O)OCC(N)=O)cc32)CC1 |
| InChI | InChI=1S/C23H26N2O3S/c1-25-10-8-16(9-11-25)23-18-5-3-2-4-15(18)6-7-20-19(23)12-17(29-20)13-22(27)28-14-21(24)26/h2-5,12H,6-11,13-14H2,1H3,(H2,24,26) |
| InChIKey | XSNDBZVCZQJQOE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |