C21H24N2O2S — CID 141241259
N-methoxy-N-[2-(1-methylpiperidin-4-ylidene)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-5-yl]formamide (PubChem CID 141241259) has the molecular formula C21H24N2O2S and a molecular weight of 368.50 g/mol. Its IUPAC name is N-methoxy-N-[2-(1-methylpiperidin-4-ylidene)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-5-yl]formamide.
| Compound Name | N-methoxy-N-[2-(1-methylpiperidin-4-ylidene)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-5-yl]formamide |
|---|---|
| PubChem CID | 141241259 |
| Molecular Formula | C21H24N2O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-methoxy-N-[2-(1-methylpiperidin-4-ylidene)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-5-yl]formamide |
| SMILES | CON(C=O)c1cc2c(s1)CCc1ccccc1C2=C1CCN(C)CC1 |
| InChI | InChI=1S/C21H24N2O2S/c1-22-11-9-16(10-12-22)21-17-6-4-3-5-15(17)7-8-19-18(21)13-20(26-19)23(14-24)25-2/h3-6,13-14H,7-12H2,1-2H3 |
| InChIKey | JQNOVKLDNVQNLP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|