C33H38ClN5O6 — CID 173090763
CID 173090763 (PubChem CID 173090763) has the molecular formula C33H38ClN5O6 and a molecular weight of 636.15 g/mol.
| Compound Name | CID 173090763 |
|---|---|
| PubChem CID | 173090763 |
| Molecular Formula | C33H38ClN5O6 |
| Molecular Weight | 636.15 g/mol |
| Exact Mass | 635.25 |
| IUPAC Name | — |
| SMILES | CCN(CC)c1ccc(C(=C2C(=O)N(c3ccccc3)N(C)C2C)c2c(C)n(C)n(-c3ccccc3)c2=O)cc1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C33H37N5O2.ClHO4/c1-7-36(8-2)26-21-19-25(20-22-26)31(29-23(3)34(5)37(32(29)39)27-15-11-9-12-16-27)30-24(4)35(6)38(33(30)40)28-17-13-10-14-18-28;2-1(3,4)5/h9-23H,7-8H2,1-6H3;(H,2,3,4,5) |
| InChIKey | PRJRBWNRPMRTKL-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 143.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.15 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|