C31H33N5O2 — CID 68529504
4-[(E)-[4-(dimethylamino)phenyl]-(1,5-dimethyl-3-oxo-2-phenylpyrazolidin-4-ylidene)methyl]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 68529504) has the molecular formula C31H33N5O2 and a molecular weight of 507.64 g/mol. Its IUPAC name is 4-[(E)-[4-(dimethylamino)phenyl]-(1,5-dimethyl-3-oxo-2-phenylpyrazolidin-4-ylidene)methyl]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[(E)-[4-(dimethylamino)phenyl]-(1,5-dimethyl-3-oxo-2-phenylpyrazolidin-4-ylidene)methyl]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 68529504 |
| Molecular Formula | C31H33N5O2 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | 4-[(E)-[4-(dimethylamino)phenyl]-(1,5-dimethyl-3-oxo-2-phenylpyrazolidin-4-ylidene)methyl]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(/C(=C2/C(=O)N(c3ccccc3)N(C)C2C)c2ccc(N(C)C)cc2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C31H33N5O2/c1-21-27(30(37)35(33(21)5)25-13-9-7-10-14-25)29(23-17-19-24(20-18-23)32(3)4)28-22(2)34(6)36(31(28)38)26-15-11-8-12-16-26/h7-21H,1-6H3/b29-27+ |
| InChIKey | PKGHAHUQWUTLFU-ORIPQNMZSA-N |
| XLogP | 4.63 |
| TPSA | 53.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|