C10H22O5Si — CID 173095588
1,1-dimethoxyethoxy-[1-(oxiran-2-ylmethoxy)propyl]silane (PubChem CID 173095588) has the molecular formula C10H22O5Si and a molecular weight of 250.37 g/mol. Its IUPAC name is 1,1-dimethoxyethoxy-[1-(oxiran-2-ylmethoxy)propyl]silane.
| Compound Name | 1,1-dimethoxyethoxy-[1-(oxiran-2-ylmethoxy)propyl]silane |
|---|---|
| PubChem CID | 173095588 |
| Molecular Formula | C10H22O5Si |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 1,1-dimethoxyethoxy-[1-(oxiran-2-ylmethoxy)propyl]silane |
| SMILES | CCC(OCC1CO1)[SiH2]OC(C)(OC)OC |
| InChI | InChI=1S/C10H22O5Si/c1-5-9(14-7-8-6-13-8)16-15-10(2,11-3)12-4/h8-9H,5-7,16H2,1-4H3 |
| InChIKey | FDFDOVMLUVNBRT-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|