C17H34O2 — CID 89079349
2-[(7-ethyl-5,5,7-trimethylnonan-3-yl)oxymethyl]oxirane (PubChem CID 89079349) has the molecular formula C17H34O2 and a molecular weight of 270.46 g/mol. Its IUPAC name is 2-[(7-ethyl-5,5,7-trimethylnonan-3-yl)oxymethyl]oxirane.
| Compound Name | 2-[(7-ethyl-5,5,7-trimethylnonan-3-yl)oxymethyl]oxirane |
|---|---|
| PubChem CID | 89079349 |
| Molecular Formula | C17H34O2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.26 |
| IUPAC Name | 2-[(7-ethyl-5,5,7-trimethylnonan-3-yl)oxymethyl]oxirane |
| SMILES | CCC(CC(C)(C)CC(C)(CC)CC)OCC1CO1 |
| InChI | InChI=1S/C17H34O2/c1-7-14(18-11-15-12-19-15)10-16(4,5)13-17(6,8-2)9-3/h14-15H,7-13H2,1-6H3 |
| InChIKey | ABQBZMGEUJQFGM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|