C14H28O3 — CID 88883203
2-[[4,4-dimethyl-1-[(2-methylpropan-2-yl)oxy]pentan-2-yl]oxymethyl]oxirane (PubChem CID 88883203) has the molecular formula C14H28O3 and a molecular weight of 244.37 g/mol. Its IUPAC name is 2-[[4,4-dimethyl-1-[(2-methylpropan-2-yl)oxy]pentan-2-yl]oxymethyl]oxirane.
| Compound Name | 2-[[4,4-dimethyl-1-[(2-methylpropan-2-yl)oxy]pentan-2-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 88883203 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 2-[[4,4-dimethyl-1-[(2-methylpropan-2-yl)oxy]pentan-2-yl]oxymethyl]oxirane |
| SMILES | CC(C)(C)CC(COC(C)(C)C)OCC1CO1 |
| InChI | InChI=1S/C14H28O3/c1-13(2,3)7-11(10-17-14(4,5)6)15-8-12-9-16-12/h11-12H,7-10H2,1-6H3 |
| InChIKey | HDKGTQRSKAOPTC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|