C9H15Cl3O3 — CID 91994198
2-[[1-chloro-3-(1,3-dichloropropan-2-yloxy)propan-2-yl]oxymethyl]oxirane (PubChem CID 91994198) has the molecular formula C9H15Cl3O3 and a molecular weight of 277.58 g/mol. Its IUPAC name is 2-[[1-chloro-3-(1,3-dichloropropan-2-yloxy)propan-2-yl]oxymethyl]oxirane.
| Compound Name | 2-[[1-chloro-3-(1,3-dichloropropan-2-yloxy)propan-2-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 91994198 |
| Molecular Formula | C9H15Cl3O3 |
| Molecular Weight | 277.58 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 2-[[1-chloro-3-(1,3-dichloropropan-2-yloxy)propan-2-yl]oxymethyl]oxirane |
| SMILES | ClCC(CCl)OCC(CCl)OCC1CO1 |
| InChI | InChI=1S/C9H15Cl3O3/c10-1-7(2-11)13-4-8(3-12)14-5-9-6-15-9/h7-9H,1-6H2 |
| InChIKey | WGCIWJMZGQKIER-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.58 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|