C18H20ClNO2 — CID 173096127
6,7-dimethoxy-2-methyl-3-phenyl-1H-isoquinoline;hydrochloride (PubChem CID 173096127) has the molecular formula C18H20ClNO2 and a molecular weight of 317.82 g/mol. Its IUPAC name is 6,7-dimethoxy-2-methyl-3-phenyl-1H-isoquinoline;hydrochloride.
| Compound Name | 6,7-dimethoxy-2-methyl-3-phenyl-1H-isoquinoline;hydrochloride |
|---|---|
| PubChem CID | 173096127 |
| Molecular Formula | C18H20ClNO2 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 6,7-dimethoxy-2-methyl-3-phenyl-1H-isoquinoline;hydrochloride |
| SMILES | COc1cc2c(cc1OC)CN(C)C(c1ccccc1)=C2.Cl |
| InChI | InChI=1S/C18H19NO2.ClH/c1-19-12-15-11-18(21-3)17(20-2)10-14(15)9-16(19)13-7-5-4-6-8-13;/h4-11H,12H2,1-3H3;1H |
| InChIKey | QHUFIONCOHFCHL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|