C13H17N2NaO4 — CID 173096574
sodium;hydride;(2-phenylacetyl) (2S)-2,5-diamino-5-oxopentanoate (PubChem CID 173096574) has the molecular formula C13H17N2NaO4 and a molecular weight of 288.28 g/mol. Its IUPAC name is sodium;hydride;(2-phenylacetyl) (2S)-2,5-diamino-5-oxopentanoate.
| Compound Name | sodium;hydride;(2-phenylacetyl) (2S)-2,5-diamino-5-oxopentanoate |
|---|---|
| PubChem CID | 173096574 |
| Molecular Formula | C13H17N2NaO4 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | sodium;hydride;(2-phenylacetyl) (2S)-2,5-diamino-5-oxopentanoate |
| SMILES | NC(=O)CC[C@H](N)C(=O)OC(=O)Cc1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C13H16N2O4.Na.H/c14-10(6-7-11(15)16)13(18)19-12(17)8-9-4-2-1-3-5-9;;/h1-5,10H,6-8,14H2,(H2,15,16);;/q;+1;-1/t10-;;/m0../s1 |
| InChIKey | OOIJUECLRUTBRS-XRIOVQLTSA-N |
| XLogP | -2.99 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|