C13H19N3O3 — CID 57240480
[(2S)-2-amino-3-phenylpropanoyl] 4,4-diaminobutanoate (PubChem CID 57240480) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is [(2S)-2-amino-3-phenylpropanoyl] 4,4-diaminobutanoate.
| Compound Name | [(2S)-2-amino-3-phenylpropanoyl] 4,4-diaminobutanoate |
|---|---|
| PubChem CID | 57240480 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | [(2S)-2-amino-3-phenylpropanoyl] 4,4-diaminobutanoate |
| SMILES | NC(N)CCC(=O)OC(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C13H19N3O3/c14-10(8-9-4-2-1-3-5-9)13(18)19-12(17)7-6-11(15)16/h1-5,10-11H,6-8,14-16H2/t10-/m0/s1 |
| InChIKey | MMFPHFYKJJCLSB-JTQLQIEISA-N |
| XLogP | -0.35 |
| TPSA | 121.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|