C15H23FN2 — CID 173097035
4-ethenyl-2-ethyl-7-fluoro-2-[2-(methylamino)ethyl]octa-4,6-dienenitrile (PubChem CID 173097035) has the molecular formula C15H23FN2 and a molecular weight of 250.36 g/mol. Its IUPAC name is 4-ethenyl-2-ethyl-7-fluoro-2-[2-(methylamino)ethyl]octa-4,6-dienenitrile.
| Compound Name | 4-ethenyl-2-ethyl-7-fluoro-2-[2-(methylamino)ethyl]octa-4,6-dienenitrile |
|---|---|
| PubChem CID | 173097035 |
| Molecular Formula | C15H23FN2 |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 4-ethenyl-2-ethyl-7-fluoro-2-[2-(methylamino)ethyl]octa-4,6-dienenitrile |
| SMILES | C=CC(=CC=C(C)F)CC(C#N)(CC)CCNC |
| InChI | InChI=1S/C15H23FN2/c1-5-14(8-7-13(3)16)11-15(6-2,12-17)9-10-18-4/h5,7-8,18H,1,6,9-11H2,2-4H3 |
| InChIKey | JTBUITJRRHMZPH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|