C15H29AsO7 — CID 173099943
2-[1-arsanyl-2-[(1R)-1-(2-methylpropanoyloxy)ethoxy]-2-oxoethyl]-5-methylhexanoic acid;hydrate (PubChem CID 173099943) has the molecular formula C15H29AsO7 and a molecular weight of 396.31 g/mol. Its IUPAC name is 2-[1-arsanyl-2-[(1R)-1-(2-methylpropanoyloxy)ethoxy]-2-oxoethyl]-5-methylhexanoic acid;hydrate.
| Compound Name | 2-[1-arsanyl-2-[(1R)-1-(2-methylpropanoyloxy)ethoxy]-2-oxoethyl]-5-methylhexanoic acid;hydrate |
|---|---|
| PubChem CID | 173099943 |
| Molecular Formula | C15H29AsO7 |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 2-[1-arsanyl-2-[(1R)-1-(2-methylpropanoyloxy)ethoxy]-2-oxoethyl]-5-methylhexanoic acid;hydrate |
| SMILES | CC(C)CCC(C(=O)O)C([AsH2])C(=O)O[C@H](C)OC(=O)C(C)C.O |
| InChI | InChI=1S/C15H27AsO6.H2O/c1-8(2)6-7-11(13(17)18)12(16)15(20)22-10(5)21-14(19)9(3)4;/h8-12H,6-7,16H2,1-5H3,(H,17,18);1H2/t10-,11?,12?;/m1./s1 |
| InChIKey | GCEBAPCZZNRXIA-CVEKITNISA-N |
| XLogP | 0.81 |
| TPSA | 121.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|