C14H18N2 — CID 173102385
N,N,3-tris(prop-2-enyl)pyridin-4-amine (PubChem CID 173102385) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is N,N,3-tris(prop-2-enyl)pyridin-4-amine.
| Compound Name | N,N,3-tris(prop-2-enyl)pyridin-4-amine |
|---|---|
| PubChem CID | 173102385 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | N,N,3-tris(prop-2-enyl)pyridin-4-amine |
| SMILES | C=CCc1cnccc1N(CC=C)CC=C |
| InChI | InChI=1S/C14H18N2/c1-4-7-13-12-15-9-8-14(13)16(10-5-2)11-6-3/h4-6,8-9,12H,1-3,7,10-11H2 |
| InChIKey | GLMPTQKGUIIVEJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|