C11H14N2 — CID 67923314
N,N-bis(prop-2-enyl)pyridin-3-amine (PubChem CID 67923314) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)pyridin-3-amine.
| Compound Name | N,N-bis(prop-2-enyl)pyridin-3-amine |
|---|---|
| PubChem CID | 67923314 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | N,N-bis(prop-2-enyl)pyridin-3-amine |
| SMILES | C=CCN(CC=C)c1cccnc1 |
| InChI | InChI=1S/C11H14N2/c1-3-8-13(9-4-2)11-6-5-7-12-10-11/h3-7,10H,1-2,8-9H2 |
| InChIKey | ZYRZMXPCJDJBDN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|