C9H16N2O5 — CID 173103680
4,4-dimethoxy-3-methoxyiminopiperidine-1-carboxylic acid (PubChem CID 173103680) has the molecular formula C9H16N2O5 and a molecular weight of 232.24 g/mol. Its IUPAC name is 4,4-dimethoxy-3-methoxyiminopiperidine-1-carboxylic acid.
| Compound Name | 4,4-dimethoxy-3-methoxyiminopiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 173103680 |
| Molecular Formula | C9H16N2O5 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 4,4-dimethoxy-3-methoxyiminopiperidine-1-carboxylic acid |
| SMILES | CON=C1CN(C(=O)O)CCC1(OC)OC |
| InChI | InChI=1S/C9H16N2O5/c1-14-9(15-2)4-5-11(8(12)13)6-7(9)10-16-3/h4-6H2,1-3H3,(H,12,13) |
| InChIKey | MNONODAZKNTJQK-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|