C21H42N2O7Si2 — CID 173104630
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;tri(propan-2-yl)-propan-2-ylsilyloxysilane (PubChem CID 173104630) has the molecular formula C21H42N2O7Si2 and a molecular weight of 490.75 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;tri(propan-2-yl)-propan-2-ylsilyloxysilane.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;tri(propan-2-yl)-propan-2-ylsilyloxysilane |
|---|---|
| PubChem CID | 173104630 |
| Molecular Formula | C21H42N2O7Si2 |
| Molecular Weight | 490.75 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;tri(propan-2-yl)-propan-2-ylsilyloxysilane |
| SMILES | CC(C)[SiH2]O[Si](C(C)C)(C(C)C)C(C)C.O=c1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C12H30OSi2.C9H12N2O6/c1-9(2)14-13-15(10(3)4,11(5)6)12(7)8;12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h9-12H,14H2,1-8H3;1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)/t;4-,6-,7-,8-/m.1/s1 |
| InChIKey | IREQSGVXQKPINB-DYIFJOFMSA-N |
| XLogP | 1.24 |
| TPSA | 134.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.75 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|