C21H21ClFN3O2S — CID 173104948
8-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-3-(4-fluorophenyl)sulfonylquinoline;hydrochloride (PubChem CID 173104948) has the molecular formula C21H21ClFN3O2S and a molecular weight of 433.94 g/mol. Its IUPAC name is 8-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-3-(4-fluorophenyl)sulfonylquinoline;hydrochloride.
| Compound Name | 8-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-3-(4-fluorophenyl)sulfonylquinoline;hydrochloride |
|---|---|
| PubChem CID | 173104948 |
| Molecular Formula | C21H21ClFN3O2S |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 8-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-3-(4-fluorophenyl)sulfonylquinoline;hydrochloride |
| SMILES | Cl.O=S(=O)(c1ccc(F)cc1)c1cnc2c(N3CC4CNCC4C3)cccc2c1 |
| InChI | InChI=1S/C21H20FN3O2S.ClH/c22-17-4-6-18(7-5-17)28(26,27)19-8-14-2-1-3-20(21(14)24-11-19)25-12-15-9-23-10-16(15)13-25;/h1-8,11,15-16,23H,9-10,12-13H2;1H |
| InChIKey | NUNICWJSBADBCM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |