C18H29NOS — CID 17310545
2-propylsulfanyl-N-(2,4,4-trimethylpentan-2-yl)benzamide (PubChem CID 17310545) has the molecular formula C18H29NOS and a molecular weight of 307.50 g/mol. Its IUPAC name is 2-propylsulfanyl-N-(2,4,4-trimethylpentan-2-yl)benzamide.
| Compound Name | 2-propylsulfanyl-N-(2,4,4-trimethylpentan-2-yl)benzamide |
|---|---|
| PubChem CID | 17310545 |
| Molecular Formula | C18H29NOS |
| Molecular Weight | 307.50 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 2-propylsulfanyl-N-(2,4,4-trimethylpentan-2-yl)benzamide |
| SMILES | CCCSc1ccccc1C(=O)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C18H29NOS/c1-7-12-21-15-11-9-8-10-14(15)16(20)19-18(5,6)13-17(2,3)4/h8-11H,7,12-13H2,1-6H3,(H,19,20) |
| InChIKey | PMBZDYQOCIFJOH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |