About (3R)-N'-methoxy-3-methylpentanediamide
(3R)-N'-methoxy-3-methylpentanediamide (PubChem CID 173105734) has the molecular formula C7H14N2O3
and a molecular weight of 174.20 g/mol. Its IUPAC name is (3R)-N'-methoxy-3-methylpentanediamide.
Molecular Properties
| Compound Name | (3R)-N'-methoxy-3-methylpentanediamide |
| PubChem CID | 173105734 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (3R)-N'-methoxy-3-methylpentanediamide |
| SMILES | CONC(=O)C[C@H](C)CC(N)=O |
| InChI | InChI=1S/C7H14N2O3/c1-5(3-6(8)10)4-7(11)9-12-2/h5H,3-4H2,1-2H3,(H2,8,10)(H,9,11)/t5-/m1/s1 |
| InChIKey | XTJUXNDZJVGEAV-RXMQYKEDSA-N |
| XLogP | -0.43 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R)-N'-methoxy-3-methylpentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-N'-methoxy-3-methylpentanediamide?
The IUPAC name of (3R)-N'-methoxy-3-methylpentanediamide (CID 173105734) is (3R)-N'-methoxy-3-methylpentanediamide.
What is the SMILES notation for (3R)-N'-methoxy-3-methylpentanediamide?
The canonical SMILES for (3R)-N'-methoxy-3-methylpentanediamide is CONC(=O)C[C@H](C)CC(N)=O.
What is the InChIKey of (3R)-N'-methoxy-3-methylpentanediamide?
The InChIKey is XTJUXNDZJVGEAV-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H14N2O3/c1-5(3-6(8)10)4-7(11)9-12-2/h5H,3-4H2,1-2H3,(H2,8,10)(H,9,11)/t5-/m1/s1.
What are the key properties of (3R)-N'-methoxy-3-methylpentanediamide?
(3R)-N'-methoxy-3-methylpentanediamide has a molecular weight of 174.20 g/mol, XLogP of -0.43, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-N'-methoxy-3-methylpentanediamide is sourced from PubChem (CID 173105734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).