C7H7NOS — CID 173106660
5-thiophen-3-yl-4,5-dihydro-1,2-oxazole (PubChem CID 173106660) has the molecular formula C7H7NOS and a molecular weight of 153.21 g/mol. Its IUPAC name is 5-thiophen-3-yl-4,5-dihydro-1,2-oxazole.
| Compound Name | 5-thiophen-3-yl-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 173106660 |
| Molecular Formula | C7H7NOS |
| Molecular Weight | 153.21 g/mol |
| Exact Mass | 153.02 |
| IUPAC Name | 5-thiophen-3-yl-4,5-dihydro-1,2-oxazole |
| SMILES | C1=NOC(c2ccsc2)C1 |
| InChI | InChI=1S/C7H7NOS/c1-3-8-9-7(1)6-2-4-10-5-6/h2-5,7H,1H2 |
| InChIKey | HSUPEFZVGACMNU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.21 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |