2-(difluoromethyl)-3-fluoropent-2-enoic acid

C6H7F3O2 — CID 173107025

IUPAC2-(difluoromethyl)-3-fluoropent-2-enoic acid
SMILESCCC(F)=C(C(=O)O)C(F)F
InChIInChI=1S/C6H7F3O2/c1-2-3(7)4(5(8)9)6(10)11/h5H,2H2,1H3,(H,10,11)
InChIKeyNRHHYAOTSQTOFC-UHFFFAOYSA-N
MW168.11 g/mol
LogP1.97
Rot. Bonds3

About 2-(difluoromethyl)-3-fluoropent-2-enoic acid

2-(difluoromethyl)-3-fluoropent-2-enoic acid (PubChem CID 173107025) has the molecular formula C6H7F3O2 and a molecular weight of 168.11 g/mol. Its IUPAC name is 2-(difluoromethyl)-3-fluoropent-2-enoic acid.

Molecular Properties

Compound Name2-(difluoromethyl)-3-fluoropent-2-enoic acid
PubChem CID173107025
Molecular FormulaC6H7F3O2
Molecular Weight168.11 g/mol
Exact Mass168.04
IUPAC Name2-(difluoromethyl)-3-fluoropent-2-enoic acid
SMILESCCC(F)=C(C(=O)O)C(F)F
InChIInChI=1S/C6H7F3O2/c1-2-3(7)4(5(8)9)6(10)11/h5H,2H2,1H3,(H,10,11)
InChIKeyNRHHYAOTSQTOFC-UHFFFAOYSA-N
XLogP1.97
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.11
LogP ≤ 51.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-(difluoromethyl)-3-fluoropent-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(difluoromethyl)-3-fluoropent-2-enoic acid?
The IUPAC name of 2-(difluoromethyl)-3-fluoropent-2-enoic acid (CID 173107025) is 2-(difluoromethyl)-3-fluoropent-2-enoic acid.
What is the SMILES notation for 2-(difluoromethyl)-3-fluoropent-2-enoic acid?
The canonical SMILES for 2-(difluoromethyl)-3-fluoropent-2-enoic acid is CCC(F)=C(C(=O)O)C(F)F.
What is the InChIKey of 2-(difluoromethyl)-3-fluoropent-2-enoic acid?
The InChIKey is NRHHYAOTSQTOFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7F3O2/c1-2-3(7)4(5(8)9)6(10)11/h5H,2H2,1H3,(H,10,11).
What are the key properties of 2-(difluoromethyl)-3-fluoropent-2-enoic acid?
2-(difluoromethyl)-3-fluoropent-2-enoic acid has a molecular weight of 168.11 g/mol, XLogP of 1.97, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-3-fluoropent-2-enoic acid is sourced from PubChem (CID 173107025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).