C17H23N3O2 — CID 173108829
3-ethoxy-5-[5-(4-ethylphenyl)piperidin-3-yl]-1,2,4-oxadiazole (PubChem CID 173108829) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 3-ethoxy-5-[5-(4-ethylphenyl)piperidin-3-yl]-1,2,4-oxadiazole.
| Compound Name | 3-ethoxy-5-[5-(4-ethylphenyl)piperidin-3-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 173108829 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 3-ethoxy-5-[5-(4-ethylphenyl)piperidin-3-yl]-1,2,4-oxadiazole |
| SMILES | CCOc1noc(C2CNCC(c3ccc(CC)cc3)C2)n1 |
| InChI | InChI=1S/C17H23N3O2/c1-3-12-5-7-13(8-6-12)14-9-15(11-18-10-14)16-19-17(20-22-16)21-4-2/h5-8,14-15,18H,3-4,9-11H2,1-2H3 |
| InChIKey | RXHCPAWOAKTZMG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |