About cobalt;hydroxy(dioxo)tungsten;phosphonic acid
cobalt;hydroxy(dioxo)tungsten;phosphonic acid (PubChem CID 173109190) has the molecular formula H4CoO6PW
and a molecular weight of 373.77 g/mol. Its IUPAC name is cobalt;hydroxy(dioxo)tungsten;phosphonic acid.
Molecular Properties
| Compound Name | cobalt;hydroxy(dioxo)tungsten;phosphonic acid |
| PubChem CID | 173109190 |
| Molecular Formula | H4CoO6PW |
| Molecular Weight | 373.77 g/mol |
| Exact Mass | 373.86 |
| IUPAC Name | cobalt;hydroxy(dioxo)tungsten;phosphonic acid |
| SMILES | O=[PH](O)O.O=[W](=O)O.[Co] |
| InChI | InChI=1S/Co.H3O3P.H2O.2O.W/c;1-4(2)3;;;;/h;4H,(H2,1,2,3);1H2;;;/q;;;;;+1/p-1 |
| InChIKey | BDQQNGLOZYKXID-UHFFFAOYSA-M |
| XLogP | -1.44 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.77 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cobalt;hydroxy(dioxo)tungsten;phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;hydroxy(dioxo)tungsten;phosphonic acid?
The IUPAC name of cobalt;hydroxy(dioxo)tungsten;phosphonic acid (CID 173109190) is cobalt;hydroxy(dioxo)tungsten;phosphonic acid.
What is the SMILES notation for cobalt;hydroxy(dioxo)tungsten;phosphonic acid?
The canonical SMILES for cobalt;hydroxy(dioxo)tungsten;phosphonic acid is O=[PH](O)O.O=[W](=O)O.[Co].
What is the InChIKey of cobalt;hydroxy(dioxo)tungsten;phosphonic acid?
The InChIKey is BDQQNGLOZYKXID-UHFFFAOYSA-M. The full InChI is InChI=1S/Co.H3O3P.H2O.2O.W/c;1-4(2)3;;;;/h;4H,(H2,1,2,3);1H2;;;/q;;;;;+1/p-1.
What are the key properties of cobalt;hydroxy(dioxo)tungsten;phosphonic acid?
cobalt;hydroxy(dioxo)tungsten;phosphonic acid has a molecular weight of 373.77 g/mol, XLogP of -1.44, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;hydroxy(dioxo)tungsten;phosphonic acid is sourced from PubChem (CID 173109190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).