About molybdenum;phosphonic acid
molybdenum;phosphonic acid (PubChem CID 174368435) has the molecular formula H6MoO6P2
and a molecular weight of 259.93 g/mol. Its IUPAC name is molybdenum;phosphonic acid.
Molecular Properties
| Compound Name | molybdenum;phosphonic acid |
| PubChem CID | 174368435 |
| Molecular Formula | H6MoO6P2 |
| Molecular Weight | 259.93 g/mol |
| Exact Mass | 261.87 |
| IUPAC Name | molybdenum;phosphonic acid |
| SMILES | O=[PH](O)O.O=[PH](O)O.[Mo] |
| InChI | InChI=1S/Mo.2H3O3P/c;2*1-4(2)3/h;2*4H,(H2,1,2,3) |
| InChIKey | QGFRGRBKPPHLQY-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.93 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze molybdenum;phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molybdenum;phosphonic acid?
The IUPAC name of molybdenum;phosphonic acid (CID 174368435) is molybdenum;phosphonic acid.
What is the SMILES notation for molybdenum;phosphonic acid?
The canonical SMILES for molybdenum;phosphonic acid is O=[PH](O)O.O=[PH](O)O.[Mo].
What is the InChIKey of molybdenum;phosphonic acid?
The InChIKey is QGFRGRBKPPHLQY-UHFFFAOYSA-N. The full InChI is InChI=1S/Mo.2H3O3P/c;2*1-4(2)3/h;2*4H,(H2,1,2,3).
What are the key properties of molybdenum;phosphonic acid?
molybdenum;phosphonic acid has a molecular weight of 259.93 g/mol, XLogP of -1.28, 0 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for molybdenum;phosphonic acid is sourced from PubChem (CID 174368435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).