About phosphonic acid;rhenium
phosphonic acid;rhenium (PubChem CID 173309427) has the molecular formula H6O6P2Re
and a molecular weight of 350.20 g/mol. Its IUPAC name is phosphonic acid;rhenium.
Molecular Properties
| Compound Name | phosphonic acid;rhenium |
| PubChem CID | 173309427 |
| Molecular Formula | H6O6P2Re |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 350.92 |
| IUPAC Name | phosphonic acid;rhenium |
| SMILES | O=[PH](O)O.O=[PH](O)O.[Re] |
| InChI | InChI=1S/2H3O3P.Re/c2*1-4(2)3;/h2*4H,(H2,1,2,3); |
| InChIKey | IBJVNDZGPANPHQ-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphonic acid;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphonic acid;rhenium?
The IUPAC name of phosphonic acid;rhenium (CID 173309427) is phosphonic acid;rhenium.
What is the SMILES notation for phosphonic acid;rhenium?
The canonical SMILES for phosphonic acid;rhenium is O=[PH](O)O.O=[PH](O)O.[Re].
What is the InChIKey of phosphonic acid;rhenium?
The InChIKey is IBJVNDZGPANPHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2H3O3P.Re/c2*1-4(2)3;/h2*4H,(H2,1,2,3);.
What are the key properties of phosphonic acid;rhenium?
phosphonic acid;rhenium has a molecular weight of 350.20 g/mol, XLogP of -1.28, 0 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phosphonic acid;rhenium is sourced from PubChem (CID 173309427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).