About ethenylsilane;trimethoxy-[1-(2-methylprop-2-enoxy)propyl]silane
ethenylsilane;trimethoxy-[1-(2-methylprop-2-enoxy)propyl]silane (PubChem CID 173114167) has the molecular formula C12H28O4Si2
and a molecular weight of 292.52 g/mol. Its IUPAC name is ethenylsilane;trimethoxy-[1-(2-methylprop-2-enoxy)propyl]silane.
Molecular Properties
| Compound Name | ethenylsilane;trimethoxy-[1-(2-methylprop-2-enoxy)propyl]silane |
| PubChem CID | 173114167 |
| Molecular Formula | C12H28O4Si2 |
| Molecular Weight | 292.52 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | ethenylsilane;trimethoxy-[1-(2-methylprop-2-enoxy)propyl]silane |
| SMILES | C=C(C)COC(CC)[Si](OC)(OC)OC.C=C[SiH3] |
| InChI | InChI=1S/C10H22O4Si.C2H6Si/c1-7-10(14-8-9(2)3)15(11-4,12-5)13-6;1-2-3/h10H,2,7-8H2,1,3-6H3;2H,1H2,3H3 |
| InChIKey | HUWQUWIECQGIJF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.52 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethenylsilane;trimethoxy-[1-(2-methylprop-2-enoxy)propyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenylsilane;trimethoxy-[1-(2-methylprop-2-enoxy)propyl]silane?
The IUPAC name of ethenylsilane;trimethoxy-[1-(2-methylprop-2-enoxy)propyl]silane (CID 173114167) is ethenylsilane;trimethoxy-[1-(2-methylprop-2-enoxy)propyl]silane.
What is the SMILES notation for ethenylsilane;trimethoxy-[1-(2-methylprop-2-enoxy)propyl]silane?
The canonical SMILES for ethenylsilane;trimethoxy-[1-(2-methylprop-2-enoxy)propyl]silane is C=C(C)COC(CC)[Si](OC)(OC)OC.C=C[SiH3].
What is the InChIKey of ethenylsilane;trimethoxy-[1-(2-methylprop-2-enoxy)propyl]silane?
The InChIKey is HUWQUWIECQGIJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O4Si.C2H6Si/c1-7-10(14-8-9(2)3)15(11-4,12-5)13-6;1-2-3/h10H,2,7-8H2,1,3-6H3;2H,1H2,3H3.
What are the key properties of ethenylsilane;trimethoxy-[1-(2-methylprop-2-enoxy)propyl]silane?
ethenylsilane;trimethoxy-[1-(2-methylprop-2-enoxy)propyl]silane has a molecular weight of 292.52 g/mol, XLogP of 1.27, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethenylsilane;trimethoxy-[1-(2-methylprop-2-enoxy)propyl]silane is sourced from PubChem (CID 173114167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).