About triethoxymethyl-λ2-stannane
triethoxymethyl-λ2-stannane (PubChem CID 173115424) has the molecular formula C7H16O3Sn
and a molecular weight of 266.91 g/mol. Its IUPAC name is triethoxymethyl-λ2-stannane.
Molecular Properties
| Compound Name | triethoxymethyl-λ2-stannane |
| PubChem CID | 173115424 |
| Molecular Formula | C7H16O3Sn |
| Molecular Weight | 266.91 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | triethoxymethyl-λ2-stannane |
| SMILES | CCOC([SnH])(OCC)OCC |
| InChI | InChI=1S/C7H15O3.Sn.H/c1-4-8-7(9-5-2)10-6-3;;/h4-6H2,1-3H3;; |
| InChIKey | NFKVVMDGRFOXJE-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.91 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze triethoxymethyl-λ2-stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethoxymethyl-λ2-stannane?
The IUPAC name of triethoxymethyl-λ2-stannane (CID 173115424) is triethoxymethyl-λ2-stannane.
What is the SMILES notation for triethoxymethyl-λ2-stannane?
The canonical SMILES for triethoxymethyl-λ2-stannane is CCOC([SnH])(OCC)OCC.
What is the InChIKey of triethoxymethyl-λ2-stannane?
The InChIKey is NFKVVMDGRFOXJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15O3.Sn.H/c1-4-8-7(9-5-2)10-6-3;;/h4-6H2,1-3H3;;.
What are the key properties of triethoxymethyl-λ2-stannane?
triethoxymethyl-λ2-stannane has a molecular weight of 266.91 g/mol, XLogP of 0.61, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triethoxymethyl-λ2-stannane is sourced from PubChem (CID 173115424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).