About CID 87590887
CID 87590887 (PubChem CID 87590887) has the molecular formula C7H15O3Sn
and a molecular weight of 265.90 g/mol.
Molecular Properties
| Compound Name | CID 87590887 |
| PubChem CID | 87590887 |
| Molecular Formula | C7H15O3Sn |
| Molecular Weight | 265.90 g/mol |
| Exact Mass | 267.00 |
| IUPAC Name | — |
| SMILES | CCOC([Sn])(OCC)OCC |
| InChI | InChI=1S/C7H15O3.Sn/c1-4-8-7(9-5-2)10-6-3;/h4-6H2,1-3H3; |
| InChIKey | QZNYXFDKQBPUQE-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.90 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 87590887 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87590887?
The IUPAC name of CID 87590887 (CID 87590887) is not available.
What is the SMILES notation for CID 87590887?
The canonical SMILES for CID 87590887 is CCOC([Sn])(OCC)OCC.
What is the InChIKey of CID 87590887?
The InChIKey is QZNYXFDKQBPUQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15O3.Sn/c1-4-8-7(9-5-2)10-6-3;/h4-6H2,1-3H3;.
What are the key properties of CID 87590887?
CID 87590887 has a molecular weight of 265.90 g/mol, XLogP of 0.88, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87590887 is sourced from PubChem (CID 87590887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).