C18H38O3Si — CID 173115895
1,1,2-tripentoxyprop-2-enylsilane (PubChem CID 173115895) has the molecular formula C18H38O3Si and a molecular weight of 330.59 g/mol. Its IUPAC name is 1,1,2-tripentoxyprop-2-enylsilane.
| Compound Name | 1,1,2-tripentoxyprop-2-enylsilane |
|---|---|
| PubChem CID | 173115895 |
| Molecular Formula | C18H38O3Si |
| Molecular Weight | 330.59 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | 1,1,2-tripentoxyprop-2-enylsilane |
| SMILES | C=C(OCCCCC)C([SiH3])(OCCCCC)OCCCCC |
| InChI | InChI=1S/C18H38O3Si/c1-5-8-11-14-19-17(4)18(22,20-15-12-9-6-2)21-16-13-10-7-3/h4-16H2,1-3,22H3 |
| InChIKey | CFDDACYOGPZCEE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.59 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|