C16H28O6Si — CID 173115984
(1,1-diacetyloxy-3,6-dimethyl-1-silylheptan-4-yl) prop-2-enoate (PubChem CID 173115984) has the molecular formula C16H28O6Si and a molecular weight of 344.48 g/mol. Its IUPAC name is (1,1-diacetyloxy-3,6-dimethyl-1-silylheptan-4-yl) prop-2-enoate.
| Compound Name | (1,1-diacetyloxy-3,6-dimethyl-1-silylheptan-4-yl) prop-2-enoate |
|---|---|
| PubChem CID | 173115984 |
| Molecular Formula | C16H28O6Si |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (1,1-diacetyloxy-3,6-dimethyl-1-silylheptan-4-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC(CC(C)C)C(C)CC([SiH3])(OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C16H28O6Si/c1-7-15(19)20-14(8-10(2)3)11(4)9-16(23,21-12(5)17)22-13(6)18/h7,10-11,14H,1,8-9H2,2-6,23H3 |
| InChIKey | WUXYQDCOGFFXCN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|