C30H28N2O2 — CID 17311665
N-benzyl-2-(3,3-diphenylpropanoylamino)-N-methylbenzamide (PubChem CID 17311665) has the molecular formula C30H28N2O2 and a molecular weight of 448.57 g/mol. Its IUPAC name is N-benzyl-2-(3,3-diphenylpropanoylamino)-N-methylbenzamide.
| Compound Name | N-benzyl-2-(3,3-diphenylpropanoylamino)-N-methylbenzamide |
|---|---|
| PubChem CID | 17311665 |
| Molecular Formula | C30H28N2O2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | N-benzyl-2-(3,3-diphenylpropanoylamino)-N-methylbenzamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1ccccc1NC(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H28N2O2/c1-32(22-23-13-5-2-6-14-23)30(34)26-19-11-12-20-28(26)31-29(33)21-27(24-15-7-3-8-16-24)25-17-9-4-10-18-25/h2-20,27H,21-22H2,1H3,(H,31,33) |
| InChIKey | PDBOTNHDWFABCF-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |