C33H39ClN3S2+ — CID 173117090
3-[2-[2-[(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]-5-phenyl-2H-1,3-benzothiazol-3-yl]propyl-trimethylazanium (PubChem CID 173117090) has the molecular formula C33H39ClN3S2+ and a molecular weight of 577.28 g/mol. Its IUPAC name is 3-[2-[2-[(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]-5-phenyl-2H-1,3-benzothiazol-3-yl]propyl-trimethylazanium.
| Compound Name | 3-[2-[2-[(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]-5-phenyl-2H-1,3-benzothiazol-3-yl]propyl-trimethylazanium |
|---|---|
| PubChem CID | 173117090 |
| Molecular Formula | C33H39ClN3S2+ |
| Molecular Weight | 577.28 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | 3-[2-[2-[(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]-5-phenyl-2H-1,3-benzothiazol-3-yl]propyl-trimethylazanium |
| SMILES | CCC(=CC1Sc2ccc(-c3ccccc3)cc2N1CCC[N+](C)(C)C)C=C1Sc2ccc(Cl)cc2N1CC |
| InChI | InChI=1S/C33H39ClN3S2/c1-6-24(20-32-35(7-2)29-23-27(34)15-17-31(29)38-32)21-33-36(18-11-19-37(3,4)5)28-22-26(14-16-30(28)39-33)25-12-9-8-10-13-25/h8-10,12-17,20-23,33H,6-7,11,18-19H2,1-5H3/q+1 |
| InChIKey | JKZMBOYUYGDZRW-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.28 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|