About azepane;1-azoniabicyclo[3.2.0]heptan-5-yl(cyclopentyl)methanone
azepane;1-azoniabicyclo[3.2.0]heptan-5-yl(cyclopentyl)methanone (PubChem CID 173118349) has the molecular formula C18H33N2O+
and a molecular weight of 293.48 g/mol. Its IUPAC name is azepane;1-azoniabicyclo[3.2.0]heptan-5-yl(cyclopentyl)methanone.
Molecular Properties
| Compound Name | azepane;1-azoniabicyclo[3.2.0]heptan-5-yl(cyclopentyl)methanone |
| PubChem CID | 173118349 |
| Molecular Formula | C18H33N2O+ |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.26 |
| IUPAC Name | azepane;1-azoniabicyclo[3.2.0]heptan-5-yl(cyclopentyl)methanone |
| SMILES | C1CCCNCC1.O=C(C1CCCC1)C12CCC[NH+]1CC2 |
| InChI | InChI=1S/C12H19NO.C6H13N/c14-11(10-4-1-2-5-10)12-6-3-8-13(12)9-7-12;1-2-4-6-7-5-3-1/h10H,1-9H2;7H,1-6H2/p+1 |
| InChIKey | XPOUAVYNZUCYBI-UHFFFAOYSA-O |
| XLogP | 1.72 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azepane;1-azoniabicyclo[3.2.0]heptan-5-yl(cyclopentyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepane;1-azoniabicyclo[3.2.0]heptan-5-yl(cyclopentyl)methanone?
The IUPAC name of azepane;1-azoniabicyclo[3.2.0]heptan-5-yl(cyclopentyl)methanone (CID 173118349) is azepane;1-azoniabicyclo[3.2.0]heptan-5-yl(cyclopentyl)methanone.
What is the SMILES notation for azepane;1-azoniabicyclo[3.2.0]heptan-5-yl(cyclopentyl)methanone?
The canonical SMILES for azepane;1-azoniabicyclo[3.2.0]heptan-5-yl(cyclopentyl)methanone is C1CCCNCC1.O=C(C1CCCC1)C12CCC[NH+]1CC2.
What is the InChIKey of azepane;1-azoniabicyclo[3.2.0]heptan-5-yl(cyclopentyl)methanone?
The InChIKey is XPOUAVYNZUCYBI-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H19NO.C6H13N/c14-11(10-4-1-2-5-10)12-6-3-8-13(12)9-7-12;1-2-4-6-7-5-3-1/h10H,1-9H2;7H,1-6H2/p+1.
What are the key properties of azepane;1-azoniabicyclo[3.2.0]heptan-5-yl(cyclopentyl)methanone?
azepane;1-azoniabicyclo[3.2.0]heptan-5-yl(cyclopentyl)methanone has a molecular weight of 293.48 g/mol, XLogP of 1.72, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azepane;1-azoniabicyclo[3.2.0]heptan-5-yl(cyclopentyl)methanone is sourced from PubChem (CID 173118349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).