C14H21NO5S — CID 173118865
2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonylmethylamino]ethoxy]acetaldehyde (PubChem CID 173118865) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is 2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonylmethylamino]ethoxy]acetaldehyde.
| Compound Name | 2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonylmethylamino]ethoxy]acetaldehyde |
|---|---|
| PubChem CID | 173118865 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonylmethylamino]ethoxy]acetaldehyde |
| SMILES | COc1cc(C)c(S(=O)(=O)CNCCOCC=O)c(C)c1 |
| InChI | InChI=1S/C14H21NO5S/c1-11-8-13(19-3)9-12(2)14(11)21(17,18)10-15-4-6-20-7-5-16/h5,8-9,15H,4,6-7,10H2,1-3H3 |
| InChIKey | NYTVOCIJFSURJK-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|