C19H20FN3O5S2 — CID 173121689
N-[[(5S)-3-[3-fluoro-4-(1-sulfinyl-1,4-thiazinan-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]furan-2-carboxamide (PubChem CID 173121689) has the molecular formula C19H20FN3O5S2 and a molecular weight of 453.52 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-(1-sulfinyl-1,4-thiazinan-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]furan-2-carboxamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-(1-sulfinyl-1,4-thiazinan-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 173121689 |
| Molecular Formula | C19H20FN3O5S2 |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-(1-sulfinyl-1,4-thiazinan-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]furan-2-carboxamide |
| SMILES | O=S=S1CCN(c2ccc(N3C[C@H](CNC(=O)c4ccco4)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C19H20FN3O5S2/c20-15-10-13(3-4-16(15)22-5-8-30(29-26)9-6-22)23-12-14(28-19(23)25)11-21-18(24)17-2-1-7-27-17/h1-4,7,10,14H,5-6,8-9,11-12H2,(H,21,24)/t14-/m0/s1 |
| InChIKey | IMNCMNJKKYBOBA-AWEZNQCLSA-N |
| XLogP | 1.74 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|