C24H34N2O5S2 — CID 17312270
3-benzylsulfonyl-N-[4-[bis(2-methylpropyl)sulfamoyl]phenyl]propanamide (PubChem CID 17312270) has the molecular formula C24H34N2O5S2 and a molecular weight of 494.68 g/mol. Its IUPAC name is 3-benzylsulfonyl-N-[4-[bis(2-methylpropyl)sulfamoyl]phenyl]propanamide.
| Compound Name | 3-benzylsulfonyl-N-[4-[bis(2-methylpropyl)sulfamoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 17312270 |
| Molecular Formula | C24H34N2O5S2 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 3-benzylsulfonyl-N-[4-[bis(2-methylpropyl)sulfamoyl]phenyl]propanamide |
| SMILES | CC(C)CN(CC(C)C)S(=O)(=O)c1ccc(NC(=O)CCS(=O)(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H34N2O5S2/c1-19(2)16-26(17-20(3)4)33(30,31)23-12-10-22(11-13-23)25-24(27)14-15-32(28,29)18-21-8-6-5-7-9-21/h5-13,19-20H,14-18H2,1-4H3,(H,25,27) |
| InChIKey | MRPZARUNBGKAAH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |