C16H15F2NO3S — CID 7354611
3-benzylsulfonyl-N-(3,5-difluorophenyl)propanamide (PubChem CID 7354611) has the molecular formula C16H15F2NO3S and a molecular weight of 339.36 g/mol. Its IUPAC name is 3-benzylsulfonyl-N-(3,5-difluorophenyl)propanamide.
| Compound Name | 3-benzylsulfonyl-N-(3,5-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 7354611 |
| Molecular Formula | C16H15F2NO3S |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 3-benzylsulfonyl-N-(3,5-difluorophenyl)propanamide |
| SMILES | O=C(CCS(=O)(=O)Cc1ccccc1)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H15F2NO3S/c17-13-8-14(18)10-15(9-13)19-16(20)6-7-23(21,22)11-12-4-2-1-3-5-12/h1-5,8-10H,6-7,11H2,(H,19,20) |
| InChIKey | PVEQDNPQCSOBGV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |