C30H35F6N3O5S — CID 173123490
(2S)-N-(2-phenylacetyl)-2-[2-(3-phenylpyrrolidin-1-yl)ethylamino]-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide;2,2,2-trifluoroacetic acid (PubChem CID 173123490) has the molecular formula C30H35F6N3O5S and a molecular weight of 663.68 g/mol. Its IUPAC name is (2S)-N-(2-phenylacetyl)-2-[2-(3-phenylpyrrolidin-1-yl)ethylamino]-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-N-(2-phenylacetyl)-2-[2-(3-phenylpyrrolidin-1-yl)ethylamino]-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 173123490 |
| Molecular Formula | C30H35F6N3O5S |
| Molecular Weight | 663.68 g/mol |
| Exact Mass | 663.22 |
| IUPAC Name | (2S)-N-(2-phenylacetyl)-2-[2-(3-phenylpyrrolidin-1-yl)ethylamino]-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(Cc1ccccc1)NC(=O)[C@H](CCCSCC(=O)C(F)(F)F)NCCN1CCC(c2ccccc2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H34F3N3O3S.C2HF3O2/c29-28(30,31)25(35)20-38-17-7-12-24(27(37)33-26(36)18-21-8-3-1-4-9-21)32-14-16-34-15-13-23(19-34)22-10-5-2-6-11-22;3-2(4,5)1(6)7/h1-6,8-11,23-24,32H,7,12-20H2,(H,33,36,37);(H,6,7)/t23?,24-;/m0./s1 |
| InChIKey | AOHBVMKTCQLOBW-ZAPAOSNUSA-N |
| XLogP | 4.60 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.68 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|