C28H34F3N3O3S — CID 87698826
(2S)-N-(1-benzylpiperidin-4-yl)-2-[(2-phenylacetyl)amino]-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide (PubChem CID 87698826) has the molecular formula C28H34F3N3O3S and a molecular weight of 549.66 g/mol. Its IUPAC name is (2S)-N-(1-benzylpiperidin-4-yl)-2-[(2-phenylacetyl)amino]-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide.
| Compound Name | (2S)-N-(1-benzylpiperidin-4-yl)-2-[(2-phenylacetyl)amino]-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide |
|---|---|
| PubChem CID | 87698826 |
| Molecular Formula | C28H34F3N3O3S |
| Molecular Weight | 549.66 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | (2S)-N-(1-benzylpiperidin-4-yl)-2-[(2-phenylacetyl)amino]-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide |
| SMILES | O=C(Cc1ccccc1)N[C@@H](CCCSCC(=O)C(F)(F)F)C(=O)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H34F3N3O3S/c29-28(30,31)25(35)20-38-17-7-12-24(33-26(36)18-21-8-3-1-4-9-21)27(37)32-23-13-15-34(16-14-23)19-22-10-5-2-6-11-22/h1-6,8-11,23-24H,7,12-20H2,(H,32,37)(H,33,36)/t24-/m0/s1 |
| InChIKey | DOBOFPSZSCYZNJ-DEOSSOPVSA-N |
| XLogP | 4.14 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.66 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|