C26H32F3N3O3S2 — CID 87629050
(2S)-2-[(1-benzylpiperidin-4-yl)-(2-thiophen-3-ylacetyl)amino]-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide (PubChem CID 87629050) has the molecular formula C26H32F3N3O3S2 and a molecular weight of 555.69 g/mol. Its IUPAC name is (2S)-2-[(1-benzylpiperidin-4-yl)-(2-thiophen-3-ylacetyl)amino]-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide.
| Compound Name | (2S)-2-[(1-benzylpiperidin-4-yl)-(2-thiophen-3-ylacetyl)amino]-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide |
|---|---|
| PubChem CID | 87629050 |
| Molecular Formula | C26H32F3N3O3S2 |
| Molecular Weight | 555.69 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | (2S)-2-[(1-benzylpiperidin-4-yl)-(2-thiophen-3-ylacetyl)amino]-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide |
| SMILES | NC(=O)[C@H](CCCSCC(=O)C(F)(F)F)N(C(=O)Cc1ccsc1)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H32F3N3O3S2/c27-26(28,29)23(33)18-36-13-4-7-22(25(30)35)32(24(34)15-20-10-14-37-17-20)21-8-11-31(12-9-21)16-19-5-2-1-3-6-19/h1-3,5-6,10,14,17,21-22H,4,7-9,11-13,15-16,18H2,(H2,30,35)/t22-/m0/s1 |
| InChIKey | VCALEQMDWAWMFD-QFIPXVFZSA-N |
| XLogP | 4.28 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.69 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|