C19H22ClN3O — CID 173123664
3-[5-(4-chlorophenoxy)-3-pyridinyl]-1-cyclopropyl-1,4-diazepane (PubChem CID 173123664) has the molecular formula C19H22ClN3O and a molecular weight of 343.86 g/mol. Its IUPAC name is 3-[5-(4-chlorophenoxy)-3-pyridinyl]-1-cyclopropyl-1,4-diazepane.
| Compound Name | 3-[5-(4-chlorophenoxy)-3-pyridinyl]-1-cyclopropyl-1,4-diazepane |
|---|---|
| PubChem CID | 173123664 |
| Molecular Formula | C19H22ClN3O |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 3-[5-(4-chlorophenoxy)-3-pyridinyl]-1-cyclopropyl-1,4-diazepane |
| SMILES | Clc1ccc(Oc2cncc(C3CN(C4CC4)CCCN3)c2)cc1 |
| InChI | InChI=1S/C19H22ClN3O/c20-15-2-6-17(7-3-15)24-18-10-14(11-21-12-18)19-13-23(16-4-5-16)9-1-8-22-19/h2-3,6-7,10-12,16,19,22H,1,4-5,8-9,13H2 |
| InChIKey | ODIRWQIZWOPIMY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |