C20H24ClN3O — CID 173088205
3-[5-(3-chlorophenoxy)-2-pyridinyl]-1-cyclobutyl-1,4-diazepane (PubChem CID 173088205) has the molecular formula C20H24ClN3O and a molecular weight of 357.89 g/mol. Its IUPAC name is 3-[5-(3-chlorophenoxy)-2-pyridinyl]-1-cyclobutyl-1,4-diazepane.
| Compound Name | 3-[5-(3-chlorophenoxy)-2-pyridinyl]-1-cyclobutyl-1,4-diazepane |
|---|---|
| PubChem CID | 173088205 |
| Molecular Formula | C20H24ClN3O |
| Molecular Weight | 357.89 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 3-[5-(3-chlorophenoxy)-2-pyridinyl]-1-cyclobutyl-1,4-diazepane |
| SMILES | Clc1cccc(Oc2ccc(C3CN(C4CCC4)CCCN3)nc2)c1 |
| InChI | InChI=1S/C20H24ClN3O/c21-15-4-1-7-17(12-15)25-18-8-9-19(23-13-18)20-14-24(11-3-10-22-20)16-5-2-6-16/h1,4,7-9,12-13,16,20,22H,2-3,5-6,10-11,14H2 |
| InChIKey | ZPSNSRONLZGTDZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.89 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |