C15H14F3N3O — CID 117231493
2-pyrrolidin-2-yl-5-[3-(trifluoromethyl)phenoxy]pyrimidine (PubChem CID 117231493) has the molecular formula C15H14F3N3O and a molecular weight of 309.29 g/mol. Its IUPAC name is 2-pyrrolidin-2-yl-5-[3-(trifluoromethyl)phenoxy]pyrimidine.
| Compound Name | 2-pyrrolidin-2-yl-5-[3-(trifluoromethyl)phenoxy]pyrimidine |
|---|---|
| PubChem CID | 117231493 |
| Molecular Formula | C15H14F3N3O |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-pyrrolidin-2-yl-5-[3-(trifluoromethyl)phenoxy]pyrimidine |
| SMILES | FC(F)(F)c1cccc(Oc2cnc(C3CCCN3)nc2)c1 |
| InChI | InChI=1S/C15H14F3N3O/c16-15(17,18)10-3-1-4-11(7-10)22-12-8-20-14(21-9-12)13-5-2-6-19-13/h1,3-4,7-9,13,19H,2,5-6H2 |
| InChIKey | FJTRBIHUXMQUIG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |