C14H16ClNO — CID 10586738
4-(4-chlorophenoxy)-1-cyclopropyl-3,6-dihydro-2H-pyridine (PubChem CID 10586738) has the molecular formula C14H16ClNO and a molecular weight of 249.74 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-1-cyclopropyl-3,6-dihydro-2H-pyridine.
| Compound Name | 4-(4-chlorophenoxy)-1-cyclopropyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 10586738 |
| Molecular Formula | C14H16ClNO |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 4-(4-chlorophenoxy)-1-cyclopropyl-3,6-dihydro-2H-pyridine |
| SMILES | Clc1ccc(OC2=CCN(C3CC3)CC2)cc1 |
| InChI | InChI=1S/C14H16ClNO/c15-11-1-5-13(6-2-11)17-14-7-9-16(10-8-14)12-3-4-12/h1-2,5-7,12H,3-4,8-10H2 |
| InChIKey | KHCDVOAEAFYQGT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |