About trimethyl oxiran-2-ylmethoxysilyl silicate
trimethyl oxiran-2-ylmethoxysilyl silicate (PubChem CID 173124097) has the molecular formula C6H16O6Si2
and a molecular weight of 240.36 g/mol. Its IUPAC name is trimethyl oxiran-2-ylmethoxysilyl silicate.
Molecular Properties
| Compound Name | trimethyl oxiran-2-ylmethoxysilyl silicate |
| PubChem CID | 173124097 |
| Molecular Formula | C6H16O6Si2 |
| Molecular Weight | 240.36 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | trimethyl oxiran-2-ylmethoxysilyl silicate |
| SMILES | CO[Si](OC)(OC)O[SiH2]OCC1CO1 |
| InChI | InChI=1S/C6H16O6Si2/c1-7-14(8-2,9-3)12-13-11-5-6-4-10-6/h6H,4-5,13H2,1-3H3 |
| InChIKey | JUSKPEBGRSVOBC-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.36 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze trimethyl oxiran-2-ylmethoxysilyl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl oxiran-2-ylmethoxysilyl silicate?
The IUPAC name of trimethyl oxiran-2-ylmethoxysilyl silicate (CID 173124097) is trimethyl oxiran-2-ylmethoxysilyl silicate.
What is the SMILES notation for trimethyl oxiran-2-ylmethoxysilyl silicate?
The canonical SMILES for trimethyl oxiran-2-ylmethoxysilyl silicate is CO[Si](OC)(OC)O[SiH2]OCC1CO1.
What is the InChIKey of trimethyl oxiran-2-ylmethoxysilyl silicate?
The InChIKey is JUSKPEBGRSVOBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O6Si2/c1-7-14(8-2,9-3)12-13-11-5-6-4-10-6/h6H,4-5,13H2,1-3H3.
What are the key properties of trimethyl oxiran-2-ylmethoxysilyl silicate?
trimethyl oxiran-2-ylmethoxysilyl silicate has a molecular weight of 240.36 g/mol, XLogP of -1.21, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl oxiran-2-ylmethoxysilyl silicate is sourced from PubChem (CID 173124097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).