C20H41NO4Si — CID 173124951
tert-butyl 4-[(3-dimethylsilyloxy-4,4-dimethylpentoxy)methyl]piperidine-1-carboxylate (PubChem CID 173124951) has the molecular formula C20H41NO4Si and a molecular weight of 387.64 g/mol. Its IUPAC name is tert-butyl 4-[(3-dimethylsilyloxy-4,4-dimethylpentoxy)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3-dimethylsilyloxy-4,4-dimethylpentoxy)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 173124951 |
| Molecular Formula | C20H41NO4Si |
| Molecular Weight | 387.64 g/mol |
| Exact Mass | 387.28 |
| IUPAC Name | tert-butyl 4-[(3-dimethylsilyloxy-4,4-dimethylpentoxy)methyl]piperidine-1-carboxylate |
| SMILES | C[SiH](C)OC(CCOCC1CCN(C(=O)OC(C)(C)C)CC1)C(C)(C)C |
| InChI | InChI=1S/C20H41NO4Si/c1-19(2,3)17(25-26(7)8)11-14-23-15-16-9-12-21(13-10-16)18(22)24-20(4,5)6/h16-17,26H,9-15H2,1-8H3 |
| InChIKey | HWTPALIYRWHRFX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.64 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|